C17H24N2O6S2 — CID 163552363
(2R)-2-[1-benzothiophen-5-ylmethylsulfonyl-[2-(2-methoxyethoxy)ethyl]amino]-N-hydroxypropanamide (PubChem CID 163552363) has the molecular formula C17H24N2O6S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2R)-2-[1-benzothiophen-5-ylmethylsulfonyl-[2-(2-methoxyethoxy)ethyl]amino]-N-hydroxypropanamide.
| Compound Name | (2R)-2-[1-benzothiophen-5-ylmethylsulfonyl-[2-(2-methoxyethoxy)ethyl]amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 163552363 |
| Molecular Formula | C17H24N2O6S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (2R)-2-[1-benzothiophen-5-ylmethylsulfonyl-[2-(2-methoxyethoxy)ethyl]amino]-N-hydroxypropanamide |
| SMILES | COCCOCCN([C@H](C)C(=O)NO)S(=O)(=O)Cc1ccc2sccc2c1 |
| InChI | InChI=1S/C17H24N2O6S2/c1-13(17(20)18-21)19(6-7-25-9-8-24-2)27(22,23)12-14-3-4-16-15(11-14)5-10-26-16/h3-5,10-11,13,21H,6-9,12H2,1-2H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | FKDAUGPWLIVBKA-CYBMUJFWSA-N |
| XLogP | 1.59 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|