C23H27NO6S — CID 22666528
2-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl-benzylamino]ethanol;oxalic acid (PubChem CID 22666528) has the molecular formula C23H27NO6S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl-benzylamino]ethanol;oxalic acid.
| Compound Name | 2-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl-benzylamino]ethanol;oxalic acid |
|---|---|
| PubChem CID | 22666528 |
| Molecular Formula | C23H27NO6S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl-benzylamino]ethanol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OCCN(CCOCCc1ccc2sccc2c1)Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO2S.C2H2O4/c23-12-10-22(17-19-4-2-1-3-5-19)11-14-24-13-8-18-6-7-21-20(16-18)9-15-25-21;3-1(4)2(5)6/h1-7,9,15-16,23H,8,10-14,17H2;(H,3,4)(H,5,6) |
| InChIKey | SDYSHBXDQIGOQJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|