C36H46N2O7S2 — CID 157227874
3-[2-(1-benzothiophen-5-yl)ethoxy]-1-(3-methylazetidin-1-yl)propan-1-one;1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]-3-methylazetidine;oxalic acid (PubChem CID 157227874) has the molecular formula C36H46N2O7S2 and a molecular weight of 682.91 g/mol. Its IUPAC name is 3-[2-(1-benzothiophen-5-yl)ethoxy]-1-(3-methylazetidin-1-yl)propan-1-one;1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]-3-methylazetidine;oxalic acid.
| Compound Name | 3-[2-(1-benzothiophen-5-yl)ethoxy]-1-(3-methylazetidin-1-yl)propan-1-one;1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]-3-methylazetidine;oxalic acid |
|---|---|
| PubChem CID | 157227874 |
| Molecular Formula | C36H46N2O7S2 |
| Molecular Weight | 682.91 g/mol |
| Exact Mass | 682.27 |
| IUPAC Name | 3-[2-(1-benzothiophen-5-yl)ethoxy]-1-(3-methylazetidin-1-yl)propan-1-one;1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]-3-methylazetidine;oxalic acid |
| SMILES | CC1CN(C(=O)CCOCCc2ccc3sccc3c2)C1.CC1CN(CCCOCCc2ccc3sccc3c2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H21NO2S.C17H23NOS.C2H2O4/c1-13-11-18(12-13)17(19)5-8-20-7-4-14-2-3-16-15(10-14)6-9-21-16;1-14-12-18(13-14)7-2-8-19-9-5-15-3-4-17-16(11-15)6-10-20-17;3-1(4)2(5)6/h2-3,6,9-10,13H,4-5,7-8,11-12H2,1H3;3-4,6,10-11,14H,2,5,7-9,12-13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | VOWAVWJHZPMWQH-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.91 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|