C18H24N2O3S — CID 86597344
[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]pyrrolidin-3-yl]carbamic acid (PubChem CID 86597344) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is [1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 86597344 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]pyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(CCCOCCc2ccc3sccc3c2)C1 |
| InChI | InChI=1S/C18H24N2O3S/c21-18(22)19-16-4-8-20(13-16)7-1-9-23-10-5-14-2-3-17-15(12-14)6-11-24-17/h2-3,6,11-12,16,19H,1,4-5,7-10,13H2,(H,21,22) |
| InChIKey | PQTKGNVGEQJOOM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|