C16H23NO3S — CID 172697943
1-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl]pyrrolidin-3-ol;hydrate (PubChem CID 172697943) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 1-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl]pyrrolidin-3-ol;hydrate.
| Compound Name | 1-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl]pyrrolidin-3-ol;hydrate |
|---|---|
| PubChem CID | 172697943 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl]pyrrolidin-3-ol;hydrate |
| SMILES | O.OC1CCN(CCOCCc2ccc3sccc3c2)C1 |
| InChI | InChI=1S/C16H21NO2S.H2O/c18-15-3-6-17(12-15)7-9-19-8-4-13-1-2-16-14(11-13)5-10-20-16;/h1-2,5,10-11,15,18H,3-4,6-9,12H2;1H2 |
| InChIKey | COOJYXMHBUMVBG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|