C36H44N2O8S2 — CID 91127899
bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] 2,3-dihydroxybutanedioate (PubChem CID 91127899) has the molecular formula C36H44N2O8S2 and a molecular weight of 696.89 g/mol. Its IUPAC name is bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] 2,3-dihydroxybutanedioate.
| Compound Name | bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 91127899 |
| Molecular Formula | C36H44N2O8S2 |
| Molecular Weight | 696.89 g/mol |
| Exact Mass | 696.25 |
| IUPAC Name | bis[1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]azetidin-3-yl] 2,3-dihydroxybutanedioate |
| SMILES | O=C(OC1CN(CCCOCCc2ccc3sccc3c2)C1)C(O)C(O)C(=O)OC1CN(CCCOCCc2ccc3sccc3c2)C1 |
| InChI | InChI=1S/C36H44N2O8S2/c39-33(35(41)45-29-21-37(22-29)11-1-13-43-15-7-25-3-5-31-27(19-25)9-17-47-31)34(40)36(42)46-30-23-38(24-30)12-2-14-44-16-8-26-4-6-32-28(20-26)10-18-48-32/h3-6,9-10,17-20,29-30,33-34,39-40H,1-2,7-8,11-16,21-24H2 |
| InChIKey | PZULMWYHZZRYRK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|