C39H39NO6S — CID 66588435
1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]-3-trityloxyazetidine;(Z)-but-2-enedioic acid (PubChem CID 66588435) has the molecular formula C39H39NO6S and a molecular weight of 649.81 g/mol. Its IUPAC name is 1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]-3-trityloxyazetidine;(Z)-but-2-enedioic acid.
| Compound Name | 1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]-3-trityloxyazetidine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 66588435 |
| Molecular Formula | C39H39NO6S |
| Molecular Weight | 649.81 g/mol |
| Exact Mass | 649.25 |
| IUPAC Name | 1-[3-[2-(1-benzothiophen-5-yl)ethoxy]propyl]-3-trityloxyazetidine;(Z)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc(C(OC2CN(CCCOCCc3ccc4sccc4c3)C2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H35NO2S.C4H4O4/c1-4-11-30(12-5-1)35(31-13-6-2-7-14-31,32-15-8-3-9-16-32)38-33-26-36(27-33)21-10-22-37-23-19-28-17-18-34-29(25-28)20-24-39-34;5-3(6)1-2-4(7)8/h1-9,11-18,20,24-25,33H,10,19,21-23,26-27H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | NHUMKNPZKLHJDP-BTJKTKAUSA-N |
| XLogP | 7.26 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.81 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|