C38H48N2O8 — CID 158692371
bis(1-[2-(2-naphthalen-2-ylethoxy)ethyl]pyrrolidin-3-ol);oxalic acid (PubChem CID 158692371) has the molecular formula C38H48N2O8 and a molecular weight of 660.81 g/mol. Its IUPAC name is bis(1-[2-(2-naphthalen-2-ylethoxy)ethyl]pyrrolidin-3-ol);oxalic acid.
| Compound Name | bis(1-[2-(2-naphthalen-2-ylethoxy)ethyl]pyrrolidin-3-ol);oxalic acid |
|---|---|
| PubChem CID | 158692371 |
| Molecular Formula | C38H48N2O8 |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.34 |
| IUPAC Name | bis(1-[2-(2-naphthalen-2-ylethoxy)ethyl]pyrrolidin-3-ol);oxalic acid |
| SMILES | O=C(O)C(=O)O.OC1CCN(CCOCCc2ccc3ccccc3c2)C1.OC1CCN(CCOCCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/2C18H23NO2.C2H2O4/c2*20-18-7-9-19(14-18)10-12-21-11-8-15-5-6-16-3-1-2-4-17(16)13-15;3-1(4)2(5)6/h2*1-6,13,18,20H,7-12,14H2;(H,3,4)(H,5,6) |
| InChIKey | IKPZZZDMAYFQHF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|