C18H23NO2S — CID 163965973
1-[(E)-3-[2-(1-benzothiophen-5-yl)ethoxy]prop-1-enyl]piperidin-4-ol (PubChem CID 163965973) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is 1-[(E)-3-[2-(1-benzothiophen-5-yl)ethoxy]prop-1-enyl]piperidin-4-ol.
| Compound Name | 1-[(E)-3-[2-(1-benzothiophen-5-yl)ethoxy]prop-1-enyl]piperidin-4-ol |
|---|---|
| PubChem CID | 163965973 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-[(E)-3-[2-(1-benzothiophen-5-yl)ethoxy]prop-1-enyl]piperidin-4-ol |
| SMILES | OC1CCN(/C=C/COCCc2ccc3sccc3c2)CC1 |
| InChI | InChI=1S/C18H23NO2S/c20-17-4-9-19(10-5-17)8-1-11-21-12-6-15-2-3-18-16(14-15)7-13-22-18/h1-3,7-8,13-14,17,20H,4-6,9-12H2/b8-1+ |
| InChIKey | SLULIMLUNSNJGE-UNXLUWIOSA-N |
| XLogP | 3.43 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|