C17H23NO2S — CID 22666560
2-[3-(1-benzothiophen-5-yl)propoxy]-N,N-diethylacetamide (PubChem CID 22666560) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 2-[3-(1-benzothiophen-5-yl)propoxy]-N,N-diethylacetamide.
| Compound Name | 2-[3-(1-benzothiophen-5-yl)propoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 22666560 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[3-(1-benzothiophen-5-yl)propoxy]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COCCCc1ccc2sccc2c1 |
| InChI | InChI=1S/C17H23NO2S/c1-3-18(4-2)17(19)13-20-10-5-6-14-7-8-16-15(12-14)9-11-21-16/h7-9,11-12H,3-6,10,13H2,1-2H3 |
| InChIKey | RVZVIYIFRZIUGL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|