C15H22N2OS — CID 139922986
N'-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl]-N-methylethane-1,2-diamine (PubChem CID 139922986) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is N'-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 139922986 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N'-[2-[2-(1-benzothiophen-5-yl)ethoxy]ethyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCCOCCc1ccc2sccc2c1 |
| InChI | InChI=1S/C15H22N2OS/c1-16-6-7-17-8-10-18-9-4-13-2-3-15-14(12-13)5-11-19-15/h2-3,5,11-12,16-17H,4,6-10H2,1H3 |
| InChIKey | YZUMOJDNNVKAKM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|