C16H21NO2S — CID 142653428
2-[1-(1-benzothiophen-5-yl)ethoxy]-N,N-diethylacetamide (PubChem CID 142653428) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is 2-[1-(1-benzothiophen-5-yl)ethoxy]-N,N-diethylacetamide.
| Compound Name | 2-[1-(1-benzothiophen-5-yl)ethoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 142653428 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[1-(1-benzothiophen-5-yl)ethoxy]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COC(C)c1ccc2sccc2c1 |
| InChI | InChI=1S/C16H21NO2S/c1-4-17(5-2)16(18)11-19-12(3)13-6-7-15-14(10-13)8-9-20-15/h6-10,12H,4-5,11H2,1-3H3 |
| InChIKey | UMIAXBCTZIRGTH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |