About 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate
5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate (PubChem CID 158317393) has the molecular formula C21H16BrNO2S2
and a molecular weight of 458.40 g/mol. Its IUPAC name is 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate.
Molecular Properties
| Compound Name | 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate |
| PubChem CID | 158317393 |
| Molecular Formula | C21H16BrNO2S2 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate |
| SMILES | Brc1ccc2sccc2c1.CCOC(=O)C(C#N)c1ccc2sccc2c1 |
| InChI | InChI=1S/C13H11NO2S.C8H5BrS/c1-2-16-13(15)11(8-14)9-3-4-12-10(7-9)5-6-17-12;9-7-1-2-8-6(5-7)3-4-10-8/h3-7,11H,2H2,1H3;1-5H |
| InChIKey | GOKUHRCYFXHNMN-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate?
The IUPAC name of 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate (CID 158317393) is 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate.
What is the SMILES notation for 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate?
The canonical SMILES for 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate is Brc1ccc2sccc2c1.CCOC(=O)C(C#N)c1ccc2sccc2c1.
What is the InChIKey of 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate?
The InChIKey is GOKUHRCYFXHNMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2S.C8H5BrS/c1-2-16-13(15)11(8-14)9-3-4-12-10(7-9)5-6-17-12;9-7-1-2-8-6(5-7)3-4-10-8/h3-7,11H,2H2,1H3;1-5H.
What are the key properties of 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate?
5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate has a molecular weight of 458.40 g/mol, XLogP of 6.74, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-benzothiophene;ethyl 2-(1-benzothiophen-5-yl)-2-cyanoacetate is sourced from PubChem (CID 158317393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).