C17H15FN2O4S2 — CID 10200653
(2R)-2-(1-benzothiophen-5-ylmethylsulfonylamino)-2-(4-fluorophenyl)-N-hydroxyacetamide (PubChem CID 10200653) has the molecular formula C17H15FN2O4S2 and a molecular weight of 394.45 g/mol. Its IUPAC name is (2R)-2-(1-benzothiophen-5-ylmethylsulfonylamino)-2-(4-fluorophenyl)-N-hydroxyacetamide.
| Compound Name | (2R)-2-(1-benzothiophen-5-ylmethylsulfonylamino)-2-(4-fluorophenyl)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 10200653 |
| Molecular Formula | C17H15FN2O4S2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (2R)-2-(1-benzothiophen-5-ylmethylsulfonylamino)-2-(4-fluorophenyl)-N-hydroxyacetamide |
| SMILES | O=C(NO)[C@H](NS(=O)(=O)Cc1ccc2sccc2c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN2O4S2/c18-14-4-2-12(3-5-14)16(17(21)19-22)20-26(23,24)10-11-1-6-15-13(9-11)7-8-25-15/h1-9,16,20,22H,10H2,(H,19,21)/t16-/m1/s1 |
| InChIKey | IYSGTURGIZFOGE-MRXNPFEDSA-N |
| XLogP | 2.71 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|