C15H19NO4S2 — CID 87987136
N-[1-(1-benzothiophen-5-ylmethylsulfonyl)-3-methylbutyl]-N-hydroxyformamide (PubChem CID 87987136) has the molecular formula C15H19NO4S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[1-(1-benzothiophen-5-ylmethylsulfonyl)-3-methylbutyl]-N-hydroxyformamide.
| Compound Name | N-[1-(1-benzothiophen-5-ylmethylsulfonyl)-3-methylbutyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87987136 |
| Molecular Formula | C15H19NO4S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[1-(1-benzothiophen-5-ylmethylsulfonyl)-3-methylbutyl]-N-hydroxyformamide |
| SMILES | CC(C)CC(N(O)C=O)S(=O)(=O)Cc1ccc2sccc2c1 |
| InChI | InChI=1S/C15H19NO4S2/c1-11(2)7-15(16(18)10-17)22(19,20)9-12-3-4-14-13(8-12)5-6-21-14/h3-6,8,10-11,15,18H,7,9H2,1-2H3 |
| InChIKey | BWKYXDAWIOKCKG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|