C16H16N2O5S2 — CID 10110313
N-[(1S)-2-(1-benzothiophen-5-ylmethylsulfonyl)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]-N-hydroxyformamide (PubChem CID 10110313) has the molecular formula C16H16N2O5S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[(1S)-2-(1-benzothiophen-5-ylmethylsulfonyl)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]-N-hydroxyformamide.
| Compound Name | N-[(1S)-2-(1-benzothiophen-5-ylmethylsulfonyl)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 10110313 |
| Molecular Formula | C16H16N2O5S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-[(1S)-2-(1-benzothiophen-5-ylmethylsulfonyl)-1-(5-methyl-1,2-oxazol-3-yl)ethyl]-N-hydroxyformamide |
| SMILES | Cc1cc([C@@H](CS(=O)(=O)Cc2ccc3sccc3c2)N(O)C=O)no1 |
| InChI | InChI=1S/C16H16N2O5S2/c1-11-6-14(17-23-11)15(18(20)10-19)9-25(21,22)8-12-2-3-16-13(7-12)4-5-24-16/h2-7,10,15,20H,8-9H2,1H3/t15-/m1/s1 |
| InChIKey | CYHUKPUEIFVXAO-OAHLLOKOSA-N |
| XLogP | 2.70 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|