C19H17NO4S2 — CID 142097848
4-[(1S)-2-(1-benzothiophen-5-ylmethylsulfanyl)-1-[formyl(hydroxy)amino]ethyl]benzoic acid (PubChem CID 142097848) has the molecular formula C19H17NO4S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-[(1S)-2-(1-benzothiophen-5-ylmethylsulfanyl)-1-[formyl(hydroxy)amino]ethyl]benzoic acid.
| Compound Name | 4-[(1S)-2-(1-benzothiophen-5-ylmethylsulfanyl)-1-[formyl(hydroxy)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 142097848 |
| Molecular Formula | C19H17NO4S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 4-[(1S)-2-(1-benzothiophen-5-ylmethylsulfanyl)-1-[formyl(hydroxy)amino]ethyl]benzoic acid |
| SMILES | O=CN(O)[C@H](CSCc1ccc2sccc2c1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H17NO4S2/c21-12-20(24)17(14-2-4-15(5-3-14)19(22)23)11-25-10-13-1-6-18-16(9-13)7-8-26-18/h1-9,12,17,24H,10-11H2,(H,22,23)/t17-/m1/s1 |
| InChIKey | HCCYHUYIELXWOX-QGZVFWFLSA-N |
| XLogP | 4.42 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|