C21H24N2OS — CID 166370495
2-(1-benzothiophen-5-yl)-N-[2-[4-[(dimethylamino)methyl]phenyl]ethyl]acetamide (PubChem CID 166370495) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-(1-benzothiophen-5-yl)-N-[2-[4-[(dimethylamino)methyl]phenyl]ethyl]acetamide.
| Compound Name | 2-(1-benzothiophen-5-yl)-N-[2-[4-[(dimethylamino)methyl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 166370495 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-(1-benzothiophen-5-yl)-N-[2-[4-[(dimethylamino)methyl]phenyl]ethyl]acetamide |
| SMILES | CN(C)Cc1ccc(CCNC(=O)Cc2ccc3sccc3c2)cc1 |
| InChI | InChI=1S/C21H24N2OS/c1-23(2)15-17-5-3-16(4-6-17)9-11-22-21(24)14-18-7-8-20-19(13-18)10-12-25-20/h3-8,10,12-13H,9,11,14-15H2,1-2H3,(H,22,24) |
| InChIKey | GSVARHFDONSMDA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |