C13H20BrNO3S — CID 171534446
tert-butyl N-[(2S)-1-(4-bromothiophen-2-yl)oxypropan-2-yl]-N-methylcarbamate (PubChem CID 171534446) has the molecular formula C13H20BrNO3S and a molecular weight of 350.28 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(4-bromothiophen-2-yl)oxypropan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-1-(4-bromothiophen-2-yl)oxypropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 171534446 |
| Molecular Formula | C13H20BrNO3S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | tert-butyl N-[(2S)-1-(4-bromothiophen-2-yl)oxypropan-2-yl]-N-methylcarbamate |
| SMILES | C[C@@H](COc1cc(Br)cs1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20BrNO3S/c1-9(7-17-11-6-10(14)8-19-11)15(5)12(16)18-13(2,3)4/h6,8-9H,7H2,1-5H3/t9-/m0/s1 |
| InChIKey | DCXQSVDBXVEULJ-VIFPVBQESA-N |
| XLogP | 4.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |