C14H17N3O3 — CID 105062773
3-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridine-4-carboxylic acid (PubChem CID 105062773) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridine-4-carboxylic acid.
| Compound Name | 3-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105062773 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridine-4-carboxylic acid |
| SMILES | O=C1CCC2CN(c3cnccc3C(=O)O)CCC2N1 |
| InChI | InChI=1S/C14H17N3O3/c18-13-2-1-9-8-17(6-4-11(9)16-13)12-7-15-5-3-10(12)14(19)20/h3,5,7,9,11H,1-2,4,6,8H2,(H,16,18)(H,19,20) |
| InChIKey | FGYRFJGNUWBQJI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |