C12H21N3O — CID 105063370
N'-[(3-methoxy-4-pyridinyl)methyl]-N-propylethane-1,2-diamine (PubChem CID 105063370) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is N'-[(3-methoxy-4-pyridinyl)methyl]-N-propylethane-1,2-diamine.
| Compound Name | N'-[(3-methoxy-4-pyridinyl)methyl]-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 105063370 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N'-[(3-methoxy-4-pyridinyl)methyl]-N-propylethane-1,2-diamine |
| SMILES | CCCNCCNCc1ccncc1OC |
| InChI | InChI=1S/C12H21N3O/c1-3-5-13-7-8-15-9-11-4-6-14-10-12(11)16-2/h4,6,10,13,15H,3,5,7-9H2,1-2H3 |
| InChIKey | ADIFFFOEVKEBAW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|