C15H15Cl3N2O — CID 105075176
N-[[3-(2,4,5-trichlorophenoxy)-4-pyridinyl]methyl]propan-1-amine (PubChem CID 105075176) has the molecular formula C15H15Cl3N2O and a molecular weight of 345.66 g/mol. Its IUPAC name is N-[[3-(2,4,5-trichlorophenoxy)-4-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[3-(2,4,5-trichlorophenoxy)-4-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 105075176 |
| Molecular Formula | C15H15Cl3N2O |
| Molecular Weight | 345.66 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | N-[[3-(2,4,5-trichlorophenoxy)-4-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccncc1Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H15Cl3N2O/c1-2-4-19-8-10-3-5-20-9-15(10)21-14-7-12(17)11(16)6-13(14)18/h3,5-7,9,19H,2,4,8H2,1H3 |
| InChIKey | ZKIYLJJVJQKMNY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|