C14H13Cl3N2O — CID 105075180
N-[[3-(2,4,5-trichlorophenoxy)-4-pyridinyl]methyl]ethanamine (PubChem CID 105075180) has the molecular formula C14H13Cl3N2O and a molecular weight of 331.63 g/mol. Its IUPAC name is N-[[3-(2,4,5-trichlorophenoxy)-4-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[3-(2,4,5-trichlorophenoxy)-4-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 105075180 |
| Molecular Formula | C14H13Cl3N2O |
| Molecular Weight | 331.63 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | N-[[3-(2,4,5-trichlorophenoxy)-4-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1ccncc1Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl3N2O/c1-2-18-7-9-3-4-19-8-14(9)20-13-6-11(16)10(15)5-12(13)17/h3-6,8,18H,2,7H2,1H3 |
| InChIKey | PNOXOILZLIGZKE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|