C15H13Cl3FNO — CID 43314088
N-[[5-fluoro-2-(2,4,5-trichlorophenoxy)phenyl]methyl]ethanamine (PubChem CID 43314088) has the molecular formula C15H13Cl3FNO and a molecular weight of 348.63 g/mol. Its IUPAC name is N-[[5-fluoro-2-(2,4,5-trichlorophenoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[5-fluoro-2-(2,4,5-trichlorophenoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 43314088 |
| Molecular Formula | C15H13Cl3FNO |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | N-[[5-fluoro-2-(2,4,5-trichlorophenoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(F)ccc1Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl3FNO/c1-2-20-8-9-5-10(19)3-4-14(9)21-15-7-12(17)11(16)6-13(15)18/h3-7,20H,2,8H2,1H3 |
| InChIKey | CDZLGGVNLDYDTQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|