C15H14ClF2NO — CID 114855205
N-[[4-chloro-2-(2,4-difluorophenoxy)phenyl]methyl]ethanamine (PubChem CID 114855205) has the molecular formula C15H14ClF2NO and a molecular weight of 297.73 g/mol. Its IUPAC name is N-[[4-chloro-2-(2,4-difluorophenoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[4-chloro-2-(2,4-difluorophenoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 114855205 |
| Molecular Formula | C15H14ClF2NO |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-[[4-chloro-2-(2,4-difluorophenoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(Cl)cc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C15H14ClF2NO/c1-2-19-9-10-3-4-11(16)7-15(10)20-14-6-5-12(17)8-13(14)18/h3-8,19H,2,9H2,1H3 |
| InChIKey | HQTIICFRBYJDQH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |