C11H12ClN3OS — CID 105064698
2-(3-chloropropyl)-5-(3-methoxy-4-pyridinyl)-1,3,4-thiadiazole (PubChem CID 105064698) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-(3-methoxy-4-pyridinyl)-1,3,4-thiadiazole.
| Compound Name | 2-(3-chloropropyl)-5-(3-methoxy-4-pyridinyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 105064698 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-(3-chloropropyl)-5-(3-methoxy-4-pyridinyl)-1,3,4-thiadiazole |
| SMILES | COc1cnccc1-c1nnc(CCCCl)s1 |
| InChI | InChI=1S/C11H12ClN3OS/c1-16-9-7-13-6-4-8(9)11-15-14-10(17-11)3-2-5-12/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | PRIADONWBBOJNU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|