C14H24N4O10P2S2 — CID 10506474
1,2-bis(5-diethoxyphosphorylsulfanyl-1,3,4-oxadiazol-2-yl)ethane-1,2-diol (PubChem CID 10506474) has the molecular formula C14H24N4O10P2S2 and a molecular weight of 534.45 g/mol. Its IUPAC name is 1,2-bis(5-diethoxyphosphorylsulfanyl-1,3,4-oxadiazol-2-yl)ethane-1,2-diol.
| Compound Name | 1,2-bis(5-diethoxyphosphorylsulfanyl-1,3,4-oxadiazol-2-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 10506474 |
| Molecular Formula | C14H24N4O10P2S2 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | 1,2-bis(5-diethoxyphosphorylsulfanyl-1,3,4-oxadiazol-2-yl)ethane-1,2-diol |
| SMILES | CCOP(=O)(OCC)Sc1nnc(C(O)C(O)c2nnc(SP(=O)(OCC)OCC)o2)o1 |
| InChI | InChI=1S/C14H24N4O10P2S2/c1-5-23-29(21,24-6-2)31-13-17-15-11(27-13)9(19)10(20)12-16-18-14(28-12)32-30(22,25-7-3)26-8-4/h9-10,19-20H,5-8H2,1-4H3 |
| InChIKey | MGBWJYGYCGHHJF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 189.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|