C7H12N2O2S — CID 116995970
2-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butan-1-ol (PubChem CID 116995970) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 2-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butan-1-ol.
| Compound Name | 2-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 116995970 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)butan-1-ol |
| SMILES | CCC(CO)c1nnc(SC)o1 |
| InChI | InChI=1S/C7H12N2O2S/c1-3-5(4-10)6-8-9-7(11-6)12-2/h5,10H,3-4H2,1-2H3 |
| InChIKey | JCOXFFKPAQNOPZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |