C11H14N2OS — CID 142363845
2-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole (PubChem CID 142363845) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 142363845 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole |
| SMILES | C=C(/C=C\C(=C)c1nnc(SC)o1)CC |
| InChI | InChI=1S/C11H14N2OS/c1-5-8(2)6-7-9(3)10-12-13-11(14-10)15-4/h6-7H,2-3,5H2,1,4H3/b7-6- |
| InChIKey | XQOWOLAYBWFQOX-SREVYHEPSA-N |
| XLogP | 3.33 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|