C18H28N2O — CID 142996586
ethane;2-[(3E,5Z)-8-ethenylundeca-3,5,8-trien-4-yl]-5-methyl-1,3,4-oxadiazole (PubChem CID 142996586) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is ethane;2-[(3E,5Z)-8-ethenylundeca-3,5,8-trien-4-yl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | ethane;2-[(3E,5Z)-8-ethenylundeca-3,5,8-trien-4-yl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 142996586 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | ethane;2-[(3E,5Z)-8-ethenylundeca-3,5,8-trien-4-yl]-5-methyl-1,3,4-oxadiazole |
| SMILES | C=CC(=CCC)C/C=C\C(=C/CC)c1nnc(C)o1.CC |
| InChI | InChI=1S/C16H22N2O.C2H6/c1-5-9-14(7-3)11-8-12-15(10-6-2)16-18-17-13(4)19-16;1-2/h7-10,12H,3,5-6,11H2,1-2,4H3;1-2H3/b12-8-,14-9?,15-10+; |
| InChIKey | AYCCBUPZIAEOAA-SDTVOPMVSA-N |
| XLogP | 5.67 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|