C11H12N2O3 — CID 87693694
(2E,4E)-2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)hepta-2,4,6-trienoic acid (PubChem CID 87693694) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is (2E,4E)-2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)hepta-2,4,6-trienoic acid.
| Compound Name | (2E,4E)-2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 87693694 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (2E,4E)-2-methyl-4-(5-methyl-1,3,4-oxadiazol-2-yl)hepta-2,4,6-trienoic acid |
| SMILES | C=C/C=C(\C=C(/C)C(=O)O)c1nnc(C)o1 |
| InChI | InChI=1S/C11H12N2O3/c1-4-5-9(6-7(2)11(14)15)10-13-12-8(3)16-10/h4-6H,1H2,2-3H3,(H,14,15)/b7-6+,9-5+ |
| InChIKey | XNYZINNNABRNJF-CQCRHSALSA-N |
| XLogP | 1.98 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|