C10H11FN2O2 — CID 143879562
(2E,4Z)-4-fluoro-5-(5-methyl-1,3,4-oxadiazol-2-yl)hepta-2,4,6-trien-2-ol (PubChem CID 143879562) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is (2E,4Z)-4-fluoro-5-(5-methyl-1,3,4-oxadiazol-2-yl)hepta-2,4,6-trien-2-ol.
| Compound Name | (2E,4Z)-4-fluoro-5-(5-methyl-1,3,4-oxadiazol-2-yl)hepta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 143879562 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (2E,4Z)-4-fluoro-5-(5-methyl-1,3,4-oxadiazol-2-yl)hepta-2,4,6-trien-2-ol |
| SMILES | C=C/C(=C(F)\C=C(/C)O)c1nnc(C)o1 |
| InChI | InChI=1S/C10H11FN2O2/c1-4-8(9(11)5-6(2)14)10-13-12-7(3)15-10/h4-5,14H,1H2,2-3H3/b6-5+,9-8- |
| InChIKey | DEVWHMLTZGPAEU-NKEWZBFXSA-N |
| XLogP | 2.71 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|