C8H10N2O3 — CID 71691539
(E)-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enoic acid (PubChem CID 71691539) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is (E)-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 71691539 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (E)-3-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)prop-2-enoic acid |
| SMILES | CC(C)c1nnc(/C=C/C(=O)O)o1 |
| InChI | InChI=1S/C8H10N2O3/c1-5(2)8-10-9-6(13-8)3-4-7(11)12/h3-5H,1-2H3,(H,11,12)/b4-3+ |
| InChIKey | CQPZNSOWDZTHBE-ONEGZZNKSA-N |
| XLogP | 1.29 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|