C10H10BrFN2O — CID 146589116
2-[(2Z,4E)-4-bromo-1-fluorohepta-2,4,6-trien-3-yl]-5-methyl-1,3,4-oxadiazole (PubChem CID 146589116) has the molecular formula C10H10BrFN2O and a molecular weight of 273.11 g/mol. Its IUPAC name is 2-[(2Z,4E)-4-bromo-1-fluorohepta-2,4,6-trien-3-yl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[(2Z,4E)-4-bromo-1-fluorohepta-2,4,6-trien-3-yl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 146589116 |
| Molecular Formula | C10H10BrFN2O |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-[(2Z,4E)-4-bromo-1-fluorohepta-2,4,6-trien-3-yl]-5-methyl-1,3,4-oxadiazole |
| SMILES | C=C/C=C(Br)\C(=C/CF)c1nnc(C)o1 |
| InChI | InChI=1S/C10H10BrFN2O/c1-3-4-9(11)8(5-6-12)10-14-13-7(2)15-10/h3-5H,1,6H2,2H3/b8-5+,9-4+ |
| InChIKey | AIBPDDXPVIMICE-CCMAPKILSA-N |
| XLogP | 3.20 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|