C14H24N2OS — CID 142363857
ethane;2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole (PubChem CID 142363857) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is ethane;2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole.
| Compound Name | ethane;2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 142363857 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | ethane;2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole |
| SMILES | C=C(C)/C=C\C(=C)c1nnc(SC)o1.CC.CC |
| InChI | InChI=1S/C10H12N2OS.2C2H6/c1-7(2)5-6-8(3)9-11-12-10(13-9)14-4;2*1-2/h5-6H,1,3H2,2,4H3;2*1-2H3/b6-5-;; |
| InChIKey | RTXBUIDJBFVAMQ-XNOMRPDFSA-N |
| XLogP | 4.99 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|