C15H26N2OS — CID 142363844
ethane;2-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole (PubChem CID 142363844) has the molecular formula C15H26N2OS and a molecular weight of 282.45 g/mol. Its IUPAC name is ethane;2-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole.
| Compound Name | ethane;2-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 142363844 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | ethane;2-[(3Z)-5-methylidenehepta-1,3-dien-2-yl]-5-methylsulfanyl-1,3,4-oxadiazole |
| SMILES | C=C(/C=C\C(=C)c1nnc(SC)o1)CC.CC.CC |
| InChI | InChI=1S/C11H14N2OS.2C2H6/c1-5-8(2)6-7-9(3)10-12-13-11(14-10)15-4;2*1-2/h6-7H,2-3,5H2,1,4H3;2*1-2H3/b7-6-;; |
| InChIKey | OBUDMQLRRLPUHB-AQTVDGORSA-N |
| XLogP | 5.38 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|