C4H4I2N2OS — CID 59896307
2-(diiodomethyl)-5-methylsulfanyl-1,3,4-oxadiazole (PubChem CID 59896307) has the molecular formula C4H4I2N2OS and a molecular weight of 381.96 g/mol. Its IUPAC name is 2-(diiodomethyl)-5-methylsulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-(diiodomethyl)-5-methylsulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 59896307 |
| Molecular Formula | C4H4I2N2OS |
| Molecular Weight | 381.96 g/mol |
| Exact Mass | 381.81 |
| IUPAC Name | 2-(diiodomethyl)-5-methylsulfanyl-1,3,4-oxadiazole |
| SMILES | CSc1nnc(C(I)I)o1 |
| InChI | InChI=1S/C4H4I2N2OS/c1-10-4-8-7-3(9-4)2(5)6/h2H,1H3 |
| InChIKey | BAYSPLGGVQZNNF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.96 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|