C13H18N2OS — CID 86187028
2-(1-adamantyl)-5-methylsulfanyl-1,3,4-oxadiazole (PubChem CID 86187028) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-(1-adamantyl)-5-methylsulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-(1-adamantyl)-5-methylsulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 86187028 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(1-adamantyl)-5-methylsulfanyl-1,3,4-oxadiazole |
| SMILES | CSc1nnc(C23CC4CC(CC(C4)C2)C3)o1 |
| InChI | InChI=1S/C13H18N2OS/c1-17-12-15-14-11(16-12)13-5-8-2-9(6-13)4-10(3-8)7-13/h8-10H,2-7H2,1H3 |
| InChIKey | AUBZWURJLLOXNZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |