C10H20N3OS+ — CID 2006912
[(1S)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-methylpropyl]azanium (PubChem CID 2006912) has the molecular formula C10H20N3OS+ and a molecular weight of 230.36 g/mol. Its IUPAC name is [(1S)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-methylpropyl]azanium.
| Compound Name | [(1S)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 2006912 |
| Molecular Formula | C10H20N3OS+ |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | [(1S)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-methylpropyl]azanium |
| SMILES | CCCCSc1nnc([C@@H]([NH3+])C(C)C)o1 |
| InChI | InChI=1S/C10H19N3OS/c1-4-5-6-15-10-13-12-9(14-10)8(11)7(2)3/h7-8H,4-6,11H2,1-3H3/p+1/t8-/m0/s1 |
| InChIKey | IXCKHZUJPIMGEE-QMMMGPOBSA-O |
| XLogP | 1.90 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|