C9H8N2OS2 — CID 166491663
4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)benzenethiol (PubChem CID 166491663) has the molecular formula C9H8N2OS2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)benzenethiol.
| Compound Name | 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)benzenethiol |
|---|---|
| PubChem CID | 166491663 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)benzenethiol |
| SMILES | CSc1nnc(-c2ccc(S)cc2)o1 |
| InChI | InChI=1S/C9H8N2OS2/c1-14-9-11-10-8(12-9)6-2-4-7(13)5-3-6/h2-5,13H,1H3 |
| InChIKey | NVCNAQBROHFHOF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|