C14H21N3O2S — CID 177180387
ethane;4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 177180387) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is ethane;4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)benzamide.
| Compound Name | ethane;4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 177180387 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethane;4-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | CC.CC.CSc1nnc(-c2ccc(C(N)=O)cc2)o1 |
| InChI | InChI=1S/C10H9N3O2S.2C2H6/c1-16-10-13-12-9(15-10)7-4-2-6(3-5-7)8(11)14;2*1-2/h2-5H,1H3,(H2,11,14);2*1-2H3 |
| InChIKey | ADOYSGZEELVSFM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |