C12H13FN2OS2 — CID 155520718
2-(butyldisulfanyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole (PubChem CID 155520718) has the molecular formula C12H13FN2OS2 and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(butyldisulfanyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(butyldisulfanyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 155520718 |
| Molecular Formula | C12H13FN2OS2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-(butyldisulfanyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole |
| SMILES | CCCCSSc1nnc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C12H13FN2OS2/c1-2-3-8-17-18-12-15-14-11(16-12)9-4-6-10(13)7-5-9/h4-7H,2-3,8H2,1H3 |
| InChIKey | YBYLWUGHQZSACO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|