C11H18N2O2 — CID 105065820
1-(3-methoxy-4-pyridinyl)-2-propoxyethanamine (PubChem CID 105065820) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-(3-methoxy-4-pyridinyl)-2-propoxyethanamine.
| Compound Name | 1-(3-methoxy-4-pyridinyl)-2-propoxyethanamine |
|---|---|
| PubChem CID | 105065820 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-(3-methoxy-4-pyridinyl)-2-propoxyethanamine |
| SMILES | CCCOCC(N)c1ccncc1OC |
| InChI | InChI=1S/C11H18N2O2/c1-3-6-15-8-10(12)9-4-5-13-7-11(9)14-2/h4-5,7,10H,3,6,8,12H2,1-2H3 |
| InChIKey | DYBOLRNTXOMFIS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|