C17H20N2O2 — CID 105066138
1-(3-cyclopropyloxyphenyl)-1-(3-methoxy-4-pyridinyl)-N-methylmethanamine (PubChem CID 105066138) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(3-cyclopropyloxyphenyl)-1-(3-methoxy-4-pyridinyl)-N-methylmethanamine.
| Compound Name | 1-(3-cyclopropyloxyphenyl)-1-(3-methoxy-4-pyridinyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105066138 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-(3-cyclopropyloxyphenyl)-1-(3-methoxy-4-pyridinyl)-N-methylmethanamine |
| SMILES | CNC(c1cccc(OC2CC2)c1)c1ccncc1OC |
| InChI | InChI=1S/C17H20N2O2/c1-18-17(15-8-9-19-11-16(15)20-2)12-4-3-5-14(10-12)21-13-6-7-13/h3-5,8-11,13,17-18H,6-7H2,1-2H3 |
| InChIKey | CCPHHQZMFUVNAN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |