C18H20ClNO — CID 106858802
1-(2-chloro-4-methylphenyl)-1-(3-cyclopropyloxyphenyl)-N-methylmethanamine (PubChem CID 106858802) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-1-(3-cyclopropyloxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(2-chloro-4-methylphenyl)-1-(3-cyclopropyloxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106858802 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-1-(3-cyclopropyloxyphenyl)-N-methylmethanamine |
| SMILES | CNC(c1cccc(OC2CC2)c1)c1ccc(C)cc1Cl |
| InChI | InChI=1S/C18H20ClNO/c1-12-6-9-16(17(19)10-12)18(20-2)13-4-3-5-15(11-13)21-14-7-8-14/h3-6,9-11,14,18,20H,7-8H2,1-2H3 |
| InChIKey | LEHVIRILQVJOJK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |