C10H14N2O — CID 105066695
[3-[cyclopropyl(methyl)amino]-4-pyridinyl]methanol (PubChem CID 105066695) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is [3-[cyclopropyl(methyl)amino]-4-pyridinyl]methanol.
| Compound Name | [3-[cyclopropyl(methyl)amino]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 105066695 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | [3-[cyclopropyl(methyl)amino]-4-pyridinyl]methanol |
| SMILES | CN(c1cnccc1CO)C1CC1 |
| InChI | InChI=1S/C10H14N2O/c1-12(9-2-3-9)10-6-11-5-4-8(10)7-13/h4-6,9,13H,2-3,7H2,1H3 |
| InChIKey | KNLXTWKSPZPAJQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |