C14H23N3 — CID 105074523
N-cyclobutyl-N-methyl-4-[(propan-2-ylamino)methyl]pyridin-3-amine (PubChem CID 105074523) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is N-cyclobutyl-N-methyl-4-[(propan-2-ylamino)methyl]pyridin-3-amine.
| Compound Name | N-cyclobutyl-N-methyl-4-[(propan-2-ylamino)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 105074523 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N-cyclobutyl-N-methyl-4-[(propan-2-ylamino)methyl]pyridin-3-amine |
| SMILES | CC(C)NCc1ccncc1N(C)C1CCC1 |
| InChI | InChI=1S/C14H23N3/c1-11(2)16-9-12-7-8-15-10-14(12)17(3)13-5-4-6-13/h7-8,10-11,13,16H,4-6,9H2,1-3H3 |
| InChIKey | BJTXELGCYYRKLF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |