C14H15ClN2 — CID 105067251
N-benzyl-4-(chloromethyl)-N-methylpyridin-3-amine (PubChem CID 105067251) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is N-benzyl-4-(chloromethyl)-N-methylpyridin-3-amine.
| Compound Name | N-benzyl-4-(chloromethyl)-N-methylpyridin-3-amine |
|---|---|
| PubChem CID | 105067251 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | N-benzyl-4-(chloromethyl)-N-methylpyridin-3-amine |
| SMILES | CN(Cc1ccccc1)c1cnccc1CCl |
| InChI | InChI=1S/C14H15ClN2/c1-17(11-12-5-3-2-4-6-12)14-10-16-8-7-13(14)9-15/h2-8,10H,9,11H2,1H3 |
| InChIKey | NFOCGFQKRNUNOV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|