C8H11ClN2 — CID 105067273
4-(chloromethyl)-N,N-dimethylpyridin-3-amine (PubChem CID 105067273) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 4-(chloromethyl)-N,N-dimethylpyridin-3-amine.
| Compound Name | 4-(chloromethyl)-N,N-dimethylpyridin-3-amine |
|---|---|
| PubChem CID | 105067273 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 4-(chloromethyl)-N,N-dimethylpyridin-3-amine |
| SMILES | CN(C)c1cnccc1CCl |
| InChI | InChI=1S/C8H11ClN2/c1-11(2)8-6-10-4-3-7(8)5-9/h3-4,6H,5H2,1-2H3 |
| InChIKey | OJUJHDAHVSVLSD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|