C29H28N4O5S — CID 10506730
tert-butyl 2-[5-(3-isocyanophenyl)-3-[(4-methylphenyl)sulfonylamino]-2-oxo-3H-1,4-benzodiazepin-1-yl]acetate (PubChem CID 10506730) has the molecular formula C29H28N4O5S and a molecular weight of 544.63 g/mol. Its IUPAC name is tert-butyl 2-[5-(3-isocyanophenyl)-3-[(4-methylphenyl)sulfonylamino]-2-oxo-3H-1,4-benzodiazepin-1-yl]acetate.
| Compound Name | tert-butyl 2-[5-(3-isocyanophenyl)-3-[(4-methylphenyl)sulfonylamino]-2-oxo-3H-1,4-benzodiazepin-1-yl]acetate |
|---|---|
| PubChem CID | 10506730 |
| Molecular Formula | C29H28N4O5S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | tert-butyl 2-[5-(3-isocyanophenyl)-3-[(4-methylphenyl)sulfonylamino]-2-oxo-3H-1,4-benzodiazepin-1-yl]acetate |
| SMILES | [C-]#[N+]c1cccc(C2=NC(NS(=O)(=O)c3ccc(C)cc3)C(=O)N(CC(=O)OC(C)(C)C)c3ccccc32)c1 |
| InChI | InChI=1S/C29H28N4O5S/c1-19-13-15-22(16-14-19)39(36,37)32-27-28(35)33(18-25(34)38-29(2,3)4)24-12-7-6-11-23(24)26(31-27)20-9-8-10-21(17-20)30-5/h6-17,27,32H,18H2,1-4H3 |
| InChIKey | WARZRBOIDWRFSS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|